3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid

C12H12FNO3 — CID 115060733

IUPAC3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid
SMILESO=C(O)CCC1CN=C(c2ccccc2F)O1
InChIInChI=1S/C12H12FNO3/c13-10-4-2-1-3-9(10)12-14-7-8(17-12)5-6-11(15)16/h1-4,8H,5-7H2,(H,15,16)
InChIKeyKEYVPEKADOCEEU-UHFFFAOYSA-N
MW237.23 g/mol
LogP1.84
Rot. Bonds4

About 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid

3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid (PubChem CID 115060733) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid
PubChem CID115060733
Molecular FormulaC12H12FNO3
Molecular Weight237.23 g/mol
Exact Mass237.08
IUPAC Name3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid
SMILESO=C(O)CCC1CN=C(c2ccccc2F)O1
InChIInChI=1S/C12H12FNO3/c13-10-4-2-1-3-9(10)12-14-7-8(17-12)5-6-11(15)16/h1-4,8H,5-7H2,(H,15,16)
InChIKeyKEYVPEKADOCEEU-UHFFFAOYSA-N
XLogP1.84
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.23
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid?
The IUPAC name of 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid (CID 115060733) is 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid is O=C(O)CCC1CN=C(c2ccccc2F)O1.
What is the InChIKey of 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid?
The InChIKey is KEYVPEKADOCEEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO3/c13-10-4-2-1-3-9(10)12-14-7-8(17-12)5-6-11(15)16/h1-4,8H,5-7H2,(H,15,16).
What are the key properties of 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid?
3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid has a molecular weight of 237.23 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-fluorophenyl)-4,5-dihydro-1,3-oxazol-5-yl]propanoic acid is sourced from PubChem (CID 115060733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).