About 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid
2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid (PubChem CID 115061108) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid.
Analyze 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid (CID 115061108) is 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid is CC(C)CC1=NC(CC(=O)O)CO1.
What is the InChIKey of 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid?
The InChIKey is KCNCDTPXIOZVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-6(2)3-8-10-7(5-13-8)4-9(11)12/h6-7H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid?
2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid has a molecular weight of 185.22 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 115061108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).