C11H20N2O — CID 115061939
2-piperidin-2-yl-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 115061939) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-piperidin-2-yl-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-piperidin-2-yl-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 115061939 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-piperidin-2-yl-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)C1COC(C2CCCCN2)=N1 |
| InChI | InChI=1S/C11H20N2O/c1-8(2)10-7-14-11(13-10)9-5-3-4-6-12-9/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | FGYJWXXAGDTPRZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |