C14H18N2O2 — CID 115061922
3-(2-piperidin-2-yl-4,5-dihydro-1,3-oxazol-4-yl)phenol (PubChem CID 115061922) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(2-piperidin-2-yl-4,5-dihydro-1,3-oxazol-4-yl)phenol.
| Compound Name | 3-(2-piperidin-2-yl-4,5-dihydro-1,3-oxazol-4-yl)phenol |
|---|---|
| PubChem CID | 115061922 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(2-piperidin-2-yl-4,5-dihydro-1,3-oxazol-4-yl)phenol |
| SMILES | Oc1cccc(C2COC(C3CCCCN3)=N2)c1 |
| InChI | InChI=1S/C14H18N2O2/c17-11-5-3-4-10(8-11)13-9-18-14(16-13)12-6-1-2-7-15-12/h3-5,8,12-13,15,17H,1-2,6-7,9H2 |
| InChIKey | HQRFTULODRSCME-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |