C12H16N2O2 — CID 84685747
3-[2-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-4-yl]phenol (PubChem CID 84685747) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[2-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-4-yl]phenol.
| Compound Name | 3-[2-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-4-yl]phenol |
|---|---|
| PubChem CID | 84685747 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-[2-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-4-yl]phenol |
| SMILES | NCCCC1=NC(c2cccc(O)c2)CO1 |
| InChI | InChI=1S/C12H16N2O2/c13-6-2-5-12-14-11(8-16-12)9-3-1-4-10(15)7-9/h1,3-4,7,11,15H,2,5-6,8,13H2 |
| InChIKey | HRZXCQAYWJAVBP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |