C15H19NO3 — CID 115065955
2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol (PubChem CID 115065955) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 115065955 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol |
| SMILES | COc1ccc(CC2=NC3CC(O)CCC3O2)cc1 |
| InChI | InChI=1S/C15H19NO3/c1-18-12-5-2-10(3-6-12)8-15-16-13-9-11(17)4-7-14(13)19-15/h2-3,5-6,11,13-14,17H,4,7-9H2,1H3 |
| InChIKey | LNWBLYQNSSRRKS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |