C12H18O2 — CID 11506620
(1S,7S,8S,8aR)-8-(hydroxymethyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 11506620) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,7S,8S,8aR)-8-(hydroxymethyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,7S,8S,8aR)-8-(hydroxymethyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11506620 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,7S,8S,8aR)-8-(hydroxymethyl)-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | C[C@H]1C=CC2=CCC[C@H](O)[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C12H18O2/c1-8-5-6-9-3-2-4-11(14)12(9)10(8)7-13/h3,5-6,8,10-14H,2,4,7H2,1H3/t8-,10-,11-,12-/m0/s1 |
| InChIKey | FNAMGILRFOTSRO-VGDYDELISA-N |
| XLogP | 1.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |