C13H15NO2S — CID 115066671
2-(3-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol (PubChem CID 115066671) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol.
| Compound Name | 2-(3-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 115066671 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-ol |
| SMILES | Oc1cccc(C2=NC3CCC(O)CC3S2)c1 |
| InChI | InChI=1S/C13H15NO2S/c15-9-3-1-2-8(6-9)13-14-11-5-4-10(16)7-12(11)17-13/h1-3,6,10-12,15-16H,4-5,7H2 |
| InChIKey | KTRDLLAADHBNMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |