C9H13ClO3 — CID 11506683
methyl (Z,4E)-4-(chloromethylidene)-3-methoxyhex-2-enoate (PubChem CID 11506683) has the molecular formula C9H13ClO3 and a molecular weight of 204.65 g/mol. Its IUPAC name is methyl (Z,4E)-4-(chloromethylidene)-3-methoxyhex-2-enoate.
| Compound Name | methyl (Z,4E)-4-(chloromethylidene)-3-methoxyhex-2-enoate |
|---|---|
| PubChem CID | 11506683 |
| Molecular Formula | C9H13ClO3 |
| Molecular Weight | 204.65 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | methyl (Z,4E)-4-(chloromethylidene)-3-methoxyhex-2-enoate |
| SMILES | CCC(=C\Cl)/C(=C/C(=O)OC)OC |
| InChI | InChI=1S/C9H13ClO3/c1-4-7(6-10)8(12-2)5-9(11)13-3/h5-6H,4H2,1-3H3/b7-6+,8-5- |
| InChIKey | OKVHWMKSDPXPED-NGWHPUCNSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|