C13H17ClO2 — CID 143997241
(5Z,6E)-4-(chloromethyl)-5-ethylidene-6-prop-2-enylidenepyran-2-one;ethane (PubChem CID 143997241) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is (5Z,6E)-4-(chloromethyl)-5-ethylidene-6-prop-2-enylidenepyran-2-one;ethane.
| Compound Name | (5Z,6E)-4-(chloromethyl)-5-ethylidene-6-prop-2-enylidenepyran-2-one;ethane |
|---|---|
| PubChem CID | 143997241 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (5Z,6E)-4-(chloromethyl)-5-ethylidene-6-prop-2-enylidenepyran-2-one;ethane |
| SMILES | C=C/C=c1/oc(=O)cc(CCl)/c1=C/C.CC |
| InChI | InChI=1S/C11H11ClO2.C2H6/c1-3-5-10-9(4-2)8(7-12)6-11(13)14-10;1-2/h3-6H,1,7H2,2H3;1-2H3/b9-4-,10-5+; |
| InChIKey | DDUVZHJEWFMTAT-VFDUGZRRSA-N |
| XLogP | 2.17 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|