C16H17ClO2 — CID 144983843
4-(chloromethyl)-7-methyl-7-[(1Z,3Z)-penta-1,3-dienyl]-6H-chromen-2-one (PubChem CID 144983843) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 4-(chloromethyl)-7-methyl-7-[(1Z,3Z)-penta-1,3-dienyl]-6H-chromen-2-one.
| Compound Name | 4-(chloromethyl)-7-methyl-7-[(1Z,3Z)-penta-1,3-dienyl]-6H-chromen-2-one |
|---|---|
| PubChem CID | 144983843 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(chloromethyl)-7-methyl-7-[(1Z,3Z)-penta-1,3-dienyl]-6H-chromen-2-one |
| SMILES | C/C=C\C=C/C1(C)C=c2oc(=O)cc(CCl)c2=CC1 |
| InChI | InChI=1S/C16H17ClO2/c1-3-4-5-7-16(2)8-6-13-12(11-17)9-15(18)19-14(13)10-16/h3-7,9-10H,8,11H2,1-2H3/b4-3-,7-5- |
| InChIKey | AKNKRTZKDDGFTP-MRWCJKGFSA-N |
| XLogP | 2.48 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|