C14H19N3O — CID 115069221
3-(1-benzyl-5-methoxypyrazol-4-yl)propan-1-amine (PubChem CID 115069221) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(1-benzyl-5-methoxypyrazol-4-yl)propan-1-amine.
| Compound Name | 3-(1-benzyl-5-methoxypyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 115069221 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(1-benzyl-5-methoxypyrazol-4-yl)propan-1-amine |
| SMILES | COc1c(CCCN)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C14H19N3O/c1-18-14-13(8-5-9-15)10-16-17(14)11-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11,15H2,1H3 |
| InChIKey | LNEGERZPEMXKBP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |