C13H17ClN4 — CID 115069683
4-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine (PubChem CID 115069683) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 4-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine.
| Compound Name | 4-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 115069683 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]pyrazol-5-amine |
| SMILES | NCCCc1cnn(Cc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C13H17ClN4/c14-12-5-3-10(4-6-12)9-18-13(16)11(8-17-18)2-1-7-15/h3-6,8H,1-2,7,9,15-16H2 |
| InChIKey | CZNBQKTYCGMXFJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |