C14H15ClF3N3 — CID 115068648
3-[5-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propan-1-amine (PubChem CID 115068648) has the molecular formula C14H15ClF3N3 and a molecular weight of 317.74 g/mol. Its IUPAC name is 3-[5-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propan-1-amine.
| Compound Name | 3-[5-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 115068648 |
| Molecular Formula | C14H15ClF3N3 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[5-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propan-1-amine |
| SMILES | NCCCc1cnn(Cc2ccc(C(F)(F)F)cc2)c1Cl |
| InChI | InChI=1S/C14H15ClF3N3/c15-13-11(2-1-7-19)8-20-21(13)9-10-3-5-12(6-4-10)14(16,17)18/h3-6,8H,1-2,7,9,19H2 |
| InChIKey | PUMFWXUVKVZZFG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |