About methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate
methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate (PubChem CID 11507016) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate |
| PubChem CID | 11507016 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CCC(=O)[C@@H]1CC(OC)OC |
| InChI | InChI=1S/C12H20O5/c1-15-11(14)6-8-4-5-10(13)9(8)7-12(16-2)17-3/h8-9,12H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | FZZIXOLYBHSHFN-RKDXNWHRSA-N |
| XLogP | 1.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate?
The IUPAC name of methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate (CID 11507016) is methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate.
What is the SMILES notation for methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate?
The canonical SMILES for methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate is COC(=O)C[C@H]1CCC(=O)[C@@H]1CC(OC)OC.
What is the InChIKey of methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate?
The InChIKey is FZZIXOLYBHSHFN-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H20O5/c1-15-11(14)6-8-4-5-10(13)9(8)7-12(16-2)17-3/h8-9,12H,4-7H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate?
methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate has a molecular weight of 244.29 g/mol, XLogP of 1.15, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]acetate is sourced from PubChem (CID 11507016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).