C10H13NO7 — CID 11507170
[(3R,4R)-4-acetyloxy-1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] acetate (PubChem CID 11507170) has the molecular formula C10H13NO7 and a molecular weight of 259.21 g/mol. Its IUPAC name is [(3R,4R)-4-acetyloxy-1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] acetate.
| Compound Name | [(3R,4R)-4-acetyloxy-1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 11507170 |
| Molecular Formula | C10H13NO7 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | [(3R,4R)-4-acetyloxy-1-(2-hydroxyethyl)-2,5-dioxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)N(CCO)C(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H13NO7/c1-5(13)17-7-8(18-6(2)14)10(16)11(3-4-12)9(7)15/h7-8,12H,3-4H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | NXAKUFWWEGXQGT-HTQZYQBOSA-N |
| XLogP | -1.79 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|