About tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate
tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 22837377) has the molecular formula C12H17NO6
and a molecular weight of 271.27 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate |
| PubChem CID | 22837377 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C12H17NO6/c1-7(14)18-8-5-9(15)13(11(8)17)6-10(16)19-12(2,3)4/h8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | UVKYIXXGPSSHQO-QMMMGPOBSA-N |
| XLogP | 0.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate?
The IUPAC name of tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate (CID 22837377) is tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate is CC(=O)O[C@H]1CC(=O)N(CC(=O)OC(C)(C)C)C1=O.
What is the InChIKey of tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate?
The InChIKey is UVKYIXXGPSSHQO-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H17NO6/c1-7(14)18-8-5-9(15)13(11(8)17)6-10(16)19-12(2,3)4/h8H,5-6H2,1-4H3/t8-/m0/s1.
What are the key properties of tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate?
tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate has a molecular weight of 271.27 g/mol, XLogP of 0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate is sourced from PubChem (CID 22837377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).