C12H17NO6 — CID 22837377
tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 22837377) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 22837377 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | tert-butyl 2-[(3S)-3-acetyloxy-2,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C12H17NO6/c1-7(14)18-8-5-9(15)13(11(8)17)6-10(16)19-12(2,3)4/h8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | UVKYIXXGPSSHQO-QMMMGPOBSA-N |
| XLogP | 0.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|