C12H10F3NO2S — CID 115071886
methyl 2-amino-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]acetate (PubChem CID 115071886) has the molecular formula C12H10F3NO2S and a molecular weight of 289.28 g/mol. Its IUPAC name is methyl 2-amino-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]acetate.
| Compound Name | methyl 2-amino-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]acetate |
|---|---|
| PubChem CID | 115071886 |
| Molecular Formula | C12H10F3NO2S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl 2-amino-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]acetate |
| SMILES | COC(=O)C(N)c1cc2c(C(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C12H10F3NO2S/c1-18-11(17)10(16)9-5-6-7(12(13,14)15)3-2-4-8(6)19-9/h2-5,10H,16H2,1H3 |
| InChIKey | QRBWXBIZGFLZPX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |