C12H10F3N3O4S2 — CID 87581136
(diaminomethylideneamino) 2-oxo-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]ethanesulfonate (PubChem CID 87581136) has the molecular formula C12H10F3N3O4S2 and a molecular weight of 381.36 g/mol. Its IUPAC name is (diaminomethylideneamino) 2-oxo-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]ethanesulfonate.
| Compound Name | (diaminomethylideneamino) 2-oxo-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 87581136 |
| Molecular Formula | C12H10F3N3O4S2 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | (diaminomethylideneamino) 2-oxo-2-[4-(trifluoromethyl)-1-benzothiophen-2-yl]ethanesulfonate |
| SMILES | NC(N)=NOS(=O)(=O)CC(=O)c1cc2c(C(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C12H10F3N3O4S2/c13-12(14,15)7-2-1-3-9-6(7)4-10(23-9)8(19)5-24(20,21)22-18-11(16)17/h1-4H,5H2,(H4,16,17,18) |
| InChIKey | HYEZITZXIDXURC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|