C11H10IN3O4S2 — CID 136657296
[[amino-[(4-iodo-1-benzothiophene-2-carbonyl)amino]methylidene]amino] methanesulfonate (PubChem CID 136657296) has the molecular formula C11H10IN3O4S2 and a molecular weight of 439.26 g/mol. Its IUPAC name is [[amino-[(4-iodo-1-benzothiophene-2-carbonyl)amino]methylidene]amino] methanesulfonate.
| Compound Name | [[amino-[(4-iodo-1-benzothiophene-2-carbonyl)amino]methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 136657296 |
| Molecular Formula | C11H10IN3O4S2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | [[amino-[(4-iodo-1-benzothiophene-2-carbonyl)amino]methylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C(N)NC(=O)c1cc2c(I)cccc2s1 |
| InChI | InChI=1S/C11H10IN3O4S2/c1-21(17,18)19-15-11(13)14-10(16)9-5-6-7(12)3-2-4-8(6)20-9/h2-5H,1H3,(H3,13,14,15,16) |
| InChIKey | FJSIBNADKZTFCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|