C15H19N3O7S2 — CID 173271217
[[amino-[(9-ethylsulfonyl-2,3-dihydro-1-benzoxepine-4-carbonyl)amino]methylidene]amino] methanesulfonate (PubChem CID 173271217) has the molecular formula C15H19N3O7S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is [[amino-[(9-ethylsulfonyl-2,3-dihydro-1-benzoxepine-4-carbonyl)amino]methylidene]amino] methanesulfonate.
| Compound Name | [[amino-[(9-ethylsulfonyl-2,3-dihydro-1-benzoxepine-4-carbonyl)amino]methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 173271217 |
| Molecular Formula | C15H19N3O7S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [[amino-[(9-ethylsulfonyl-2,3-dihydro-1-benzoxepine-4-carbonyl)amino]methylidene]amino] methanesulfonate |
| SMILES | CCS(=O)(=O)c1cccc2c1OCCC(C(=O)NC(N)=NOS(C)(=O)=O)=C2 |
| InChI | InChI=1S/C15H19N3O7S2/c1-3-27(22,23)12-6-4-5-10-9-11(7-8-24-13(10)12)14(19)17-15(16)18-25-26(2,20)21/h4-6,9H,3,7-8H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | KLNKWMZSMVDEJA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|