C15H19N5O3 — CID 18319563
9-N-(2-aminoethyl)-4-N-(diaminomethylidene)-2,3-dihydro-1-benzoxepine-4,9-dicarboxamide (PubChem CID 18319563) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 9-N-(2-aminoethyl)-4-N-(diaminomethylidene)-2,3-dihydro-1-benzoxepine-4,9-dicarboxamide.
| Compound Name | 9-N-(2-aminoethyl)-4-N-(diaminomethylidene)-2,3-dihydro-1-benzoxepine-4,9-dicarboxamide |
|---|---|
| PubChem CID | 18319563 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 9-N-(2-aminoethyl)-4-N-(diaminomethylidene)-2,3-dihydro-1-benzoxepine-4,9-dicarboxamide |
| SMILES | NCCNC(=O)c1cccc2c1OCCC(C(=O)N=C(N)N)=C2 |
| InChI | InChI=1S/C15H19N5O3/c16-5-6-19-14(22)11-3-1-2-9-8-10(4-7-23-12(9)11)13(21)20-15(17)18/h1-3,8H,4-7,16H2,(H,19,22)(H4,17,18,20,21) |
| InChIKey | CDQXBXHOSWAWMM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|