C15H17N3O7S — CID 57143223
methyl 4-[2-(diaminomethylideneamino)oxysulfonylacetyl]-2,3-dihydro-1-benzoxepine-9-carboxylate (PubChem CID 57143223) has the molecular formula C15H17N3O7S and a molecular weight of 383.38 g/mol. Its IUPAC name is methyl 4-[2-(diaminomethylideneamino)oxysulfonylacetyl]-2,3-dihydro-1-benzoxepine-9-carboxylate.
| Compound Name | methyl 4-[2-(diaminomethylideneamino)oxysulfonylacetyl]-2,3-dihydro-1-benzoxepine-9-carboxylate |
|---|---|
| PubChem CID | 57143223 |
| Molecular Formula | C15H17N3O7S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | methyl 4-[2-(diaminomethylideneamino)oxysulfonylacetyl]-2,3-dihydro-1-benzoxepine-9-carboxylate |
| SMILES | COC(=O)c1cccc2c1OCCC(C(=O)CS(=O)(=O)ON=C(N)N)=C2 |
| InChI | InChI=1S/C15H17N3O7S/c1-23-14(20)11-4-2-3-10-7-9(5-6-24-13(10)11)12(19)8-26(21,22)25-18-15(16)17/h2-4,7H,5-6,8H2,1H3,(H4,16,17,18) |
| InChIKey | QADYRSLZLSMEDK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|