C14H16N4O4 — CID 54505187
methyl N-[4-(diaminomethylidenecarbamoyl)-2,3-dihydro-1-benzoxepin-9-yl]carbamate (PubChem CID 54505187) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl N-[4-(diaminomethylidenecarbamoyl)-2,3-dihydro-1-benzoxepin-9-yl]carbamate.
| Compound Name | methyl N-[4-(diaminomethylidenecarbamoyl)-2,3-dihydro-1-benzoxepin-9-yl]carbamate |
|---|---|
| PubChem CID | 54505187 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl N-[4-(diaminomethylidenecarbamoyl)-2,3-dihydro-1-benzoxepin-9-yl]carbamate |
| SMILES | COC(=O)Nc1cccc2c1OCCC(C(=O)N=C(N)N)=C2 |
| InChI | InChI=1S/C14H16N4O4/c1-21-14(20)17-10-4-2-3-8-7-9(5-6-22-11(8)10)12(19)18-13(15)16/h2-4,7H,5-6H2,1H3,(H,17,20)(H4,15,16,18,19) |
| InChIKey | YFEKCXCPWTVCDU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|