C14H15NO4 — CID 73437182
methyl 9-(methoxyiminomethyl)-2,3-dihydro-1-benzoxepine-4-carboxylate (PubChem CID 73437182) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 9-(methoxyiminomethyl)-2,3-dihydro-1-benzoxepine-4-carboxylate.
| Compound Name | methyl 9-(methoxyiminomethyl)-2,3-dihydro-1-benzoxepine-4-carboxylate |
|---|---|
| PubChem CID | 73437182 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 9-(methoxyiminomethyl)-2,3-dihydro-1-benzoxepine-4-carboxylate |
| SMILES | CON=Cc1cccc2c1OCCC(C(=O)OC)=C2 |
| InChI | InChI=1S/C14H15NO4/c1-17-14(16)11-6-7-19-13-10(8-11)4-3-5-12(13)9-15-18-2/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | WZVXFRUCRXVFGI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|