About methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate
methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate (PubChem CID 58775946) has the molecular formula C12H10Cl2O3
and a molecular weight of 273.12 g/mol. Its IUPAC name is methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate.
Analyze methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate?
The IUPAC name of methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate (CID 58775946) is methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate.
What is the SMILES notation for methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate?
The canonical SMILES for methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate is COC(=O)C1=Cc2cc(Cl)c(Cl)cc2OCC1.
What is the InChIKey of methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate?
The InChIKey is SOQLJFUEBFUEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2O3/c1-16-12(15)7-2-3-17-11-6-10(14)9(13)5-8(11)4-7/h4-6H,2-3H2,1H3.
What are the key properties of methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate?
methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate has a molecular weight of 273.12 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7,8-dichloro-2,3-dihydro-1-benzoxepine-4-carboxylate is sourced from PubChem (CID 58775946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).