C17H14ClN3O4S2 — CID 136630723
[[amino-[[4-(4-chlorophenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate (PubChem CID 136630723) has the molecular formula C17H14ClN3O4S2 and a molecular weight of 423.90 g/mol. Its IUPAC name is [[amino-[[4-(4-chlorophenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate.
| Compound Name | [[amino-[[4-(4-chlorophenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 136630723 |
| Molecular Formula | C17H14ClN3O4S2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | [[amino-[[4-(4-chlorophenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON=C(N)NC(=O)c1cc2c(-c3ccc(Cl)cc3)cccc2s1 |
| InChI | InChI=1S/C17H14ClN3O4S2/c1-27(23,24)25-21-17(19)20-16(22)15-9-13-12(3-2-4-14(13)26-15)10-5-7-11(18)8-6-10/h2-9H,1H3,(H3,19,20,21,22) |
| InChIKey | WDSDLZLWYBBKPS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|