C18H16FN3O4S2 — CID 136656081
[[amino-[[4-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate (PubChem CID 136656081) has the molecular formula C18H16FN3O4S2 and a molecular weight of 421.48 g/mol. Its IUPAC name is [[amino-[[4-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate.
| Compound Name | [[amino-[[4-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 136656081 |
| Molecular Formula | C18H16FN3O4S2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | [[amino-[[4-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carbonyl]amino]methylidene]amino] methanesulfonate |
| SMILES | Cc1ccc(F)c(-c2cccc3sc(C(=O)NC(N)=NOS(C)(=O)=O)cc23)c1 |
| InChI | InChI=1S/C18H16FN3O4S2/c1-10-6-7-14(19)12(8-10)11-4-3-5-15-13(11)9-16(27-15)17(23)21-18(20)22-26-28(2,24)25/h3-9H,1-2H3,(H3,20,21,22,23) |
| InChIKey | XIRSKYWOSLWSHN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|