C18H17FN4O4S2 — CID 174534076
(diaminomethylideneamino) 2-[4-[5-(aminomethyl)-2-fluorophenyl]-1-benzothiophen-2-yl]-2-oxoethanesulfonate (PubChem CID 174534076) has the molecular formula C18H17FN4O4S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is (diaminomethylideneamino) 2-[4-[5-(aminomethyl)-2-fluorophenyl]-1-benzothiophen-2-yl]-2-oxoethanesulfonate.
| Compound Name | (diaminomethylideneamino) 2-[4-[5-(aminomethyl)-2-fluorophenyl]-1-benzothiophen-2-yl]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 174534076 |
| Molecular Formula | C18H17FN4O4S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (diaminomethylideneamino) 2-[4-[5-(aminomethyl)-2-fluorophenyl]-1-benzothiophen-2-yl]-2-oxoethanesulfonate |
| SMILES | NCc1ccc(F)c(-c2cccc3sc(C(=O)CS(=O)(=O)ON=C(N)N)cc23)c1 |
| InChI | InChI=1S/C18H17FN4O4S2/c19-14-5-4-10(8-20)6-12(14)11-2-1-3-16-13(11)7-17(28-16)15(24)9-29(25,26)27-23-18(21)22/h1-7H,8-9,20H2,(H4,21,22,23) |
| InChIKey | UEWQIRGDFXYTFN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|