C11H10O4S — CID 115072407
2-hydroxy-2-(7-methoxy-1-benzothiophen-2-yl)acetic acid (PubChem CID 115072407) has the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-hydroxy-2-(7-methoxy-1-benzothiophen-2-yl)acetic acid.
| Compound Name | 2-hydroxy-2-(7-methoxy-1-benzothiophen-2-yl)acetic acid |
|---|---|
| PubChem CID | 115072407 |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-hydroxy-2-(7-methoxy-1-benzothiophen-2-yl)acetic acid |
| SMILES | COc1cccc2cc(C(O)C(=O)O)sc12 |
| InChI | InChI=1S/C11H10O4S/c1-15-7-4-2-3-6-5-8(16-10(6)7)9(12)11(13)14/h2-5,9,12H,1H3,(H,13,14) |
| InChIKey | UTOAXQDWHJDHAR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |