C14H17ClN2O2 — CID 115072913
2-amino-2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)acetic acid (PubChem CID 115072913) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-amino-2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)acetic acid.
| Compound Name | 2-amino-2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)acetic acid |
|---|---|
| PubChem CID | 115072913 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-amino-2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)acetic acid |
| SMILES | Cc1c(C(N)C(=O)O)c2c(Cl)cccc2n1C(C)C |
| InChI | InChI=1S/C14H17ClN2O2/c1-7(2)17-8(3)11(13(16)14(18)19)12-9(15)5-4-6-10(12)17/h4-7,13H,16H2,1-3H3,(H,18,19) |
| InChIKey | BFAJYARKZCXWLN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |