C14H16ClNO3 — CID 115072918
2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)-2-hydroxyacetic acid (PubChem CID 115072918) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 115072918 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(4-chloro-2-methyl-1-propan-2-ylindol-3-yl)-2-hydroxyacetic acid |
| SMILES | Cc1c(C(O)C(=O)O)c2c(Cl)cccc2n1C(C)C |
| InChI | InChI=1S/C14H16ClNO3/c1-7(2)16-8(3)11(13(17)14(18)19)12-9(15)5-4-6-10(12)16/h4-7,13,17H,1-3H3,(H,18,19) |
| InChIKey | LXYDJUSBGIGYTB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |