C17H22O3 — CID 11507347
(2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-3-methyl-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11507347) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-3-methyl-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-3-methyl-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11507347 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-3-methyl-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | C[C@@H]1[C@H]2[C@H](CO)C[C@H](CO)[C@H]2C(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H22O3/c1-10-14-12(8-18)7-13(9-19)16(14)17(20)15(10)11-5-3-2-4-6-11/h2-6,10,12-16,18-19H,7-9H2,1H3/t10-,12+,13-,14+,15-,16-/m1/s1 |
| InChIKey | OJYLWIWTFHSFRD-IOIVRQTOSA-N |
| XLogP | 1.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |