C21H31FO2 — CID 143160779
(5S)-5-[2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-6-methylnonan-2-one (PubChem CID 143160779) has the molecular formula C21H31FO2 and a molecular weight of 334.48 g/mol. Its IUPAC name is (5S)-5-[2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-6-methylnonan-2-one.
| Compound Name | (5S)-5-[2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-6-methylnonan-2-one |
|---|---|
| PubChem CID | 143160779 |
| Molecular Formula | C21H31FO2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (5S)-5-[2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-6-methylnonan-2-one |
| SMILES | CCCC(C)[C@H](CC(O)C(C)=O)C1CCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H31FO2/c1-4-6-14(2)20(13-21(24)15(3)23)19-8-5-7-18(19)16-9-11-17(22)12-10-16/h9-12,14,18-21,24H,4-8,13H2,1-3H3/t14?,18?,19?,20-,21?/m0/s1 |
| InChIKey | FEWWDEGODWFNDE-ZJRISPBTSA-N |
| XLogP | 5.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |