C14H19NO — CID 115074494
5-(1-methylcyclopentyl)oxy-2,3-dihydro-1H-indole (PubChem CID 115074494) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 5-(1-methylcyclopentyl)oxy-2,3-dihydro-1H-indole.
| Compound Name | 5-(1-methylcyclopentyl)oxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074494 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 5-(1-methylcyclopentyl)oxy-2,3-dihydro-1H-indole |
| SMILES | CC1(Oc2ccc3c(c2)CCN3)CCCC1 |
| InChI | InChI=1S/C14H19NO/c1-14(7-2-3-8-14)16-12-4-5-13-11(10-12)6-9-15-13/h4-5,10,15H,2-3,6-9H2,1H3 |
| InChIKey | GMQGUYGILUODHY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|