C17H25NO — CID 115074571
5-(1,4,4-trimethylcyclohexyl)oxy-2,3-dihydro-1H-indole (PubChem CID 115074571) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 5-(1,4,4-trimethylcyclohexyl)oxy-2,3-dihydro-1H-indole.
| Compound Name | 5-(1,4,4-trimethylcyclohexyl)oxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074571 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 5-(1,4,4-trimethylcyclohexyl)oxy-2,3-dihydro-1H-indole |
| SMILES | CC1(C)CCC(C)(Oc2ccc3c(c2)CCN3)CC1 |
| InChI | InChI=1S/C17H25NO/c1-16(2)7-9-17(3,10-8-16)19-14-4-5-15-13(12-14)6-11-18-15/h4-5,12,18H,6-11H2,1-3H3 |
| InChIKey | OKENNLOASHPWEK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|