C13H18N2O — CID 115074953
7-(1-ethylazetidin-3-yl)oxy-2,3-dihydro-1H-indole (PubChem CID 115074953) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-(1-ethylazetidin-3-yl)oxy-2,3-dihydro-1H-indole.
| Compound Name | 7-(1-ethylazetidin-3-yl)oxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074953 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 7-(1-ethylazetidin-3-yl)oxy-2,3-dihydro-1H-indole |
| SMILES | CCN1CC(Oc2cccc3c2NCC3)C1 |
| InChI | InChI=1S/C13H18N2O/c1-2-15-8-11(9-15)16-12-5-3-4-10-6-7-14-13(10)12/h3-5,11,14H,2,6-9H2,1H3 |
| InChIKey | ZWPJQZLUQWRINT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |