C12H16N2O — CID 115075810
4-(azetidin-3-ylmethoxy)-2,3-dihydro-1H-isoindole (PubChem CID 115075810) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethoxy)-2,3-dihydro-1H-isoindole.
| Compound Name | 4-(azetidin-3-ylmethoxy)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 115075810 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(azetidin-3-ylmethoxy)-2,3-dihydro-1H-isoindole |
| SMILES | c1cc2c(c(OCC3CNC3)c1)CNC2 |
| InChI | InChI=1S/C12H16N2O/c1-2-10-6-14-7-11(10)12(3-1)15-8-9-4-13-5-9/h1-3,9,13-14H,4-8H2 |
| InChIKey | DQJUVHMETDRQGC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |