C10H17N3OS — CID 115077211
3-[5-(thian-4-yl)-1,2,4-oxadiazol-3-yl]propan-1-amine (PubChem CID 115077211) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[5-(thian-4-yl)-1,2,4-oxadiazol-3-yl]propan-1-amine.
| Compound Name | 3-[5-(thian-4-yl)-1,2,4-oxadiazol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 115077211 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[5-(thian-4-yl)-1,2,4-oxadiazol-3-yl]propan-1-amine |
| SMILES | NCCCc1noc(C2CCSCC2)n1 |
| InChI | InChI=1S/C10H17N3OS/c11-5-1-2-9-12-10(14-13-9)8-3-6-15-7-4-8/h8H,1-7,11H2 |
| InChIKey | RFNXTZAGBLMBDL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |