C9H12N2OS — CID 130660248
3-prop-2-enyl-5-(thiolan-3-yl)-1,2,4-oxadiazole (PubChem CID 130660248) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-prop-2-enyl-5-(thiolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-prop-2-enyl-5-(thiolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130660248 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-prop-2-enyl-5-(thiolan-3-yl)-1,2,4-oxadiazole |
| SMILES | C=CCc1noc(C2CCSC2)n1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-3-8-10-9(12-11-8)7-4-5-13-6-7/h2,7H,1,3-6H2 |
| InChIKey | USFDPRILKKXLHJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|