C9H12N2O2 — CID 130611413
5-[(2R)-oxolan-2-yl]-3-prop-2-enyl-1,2,4-oxadiazole (PubChem CID 130611413) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-[(2R)-oxolan-2-yl]-3-prop-2-enyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2R)-oxolan-2-yl]-3-prop-2-enyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130611413 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-[(2R)-oxolan-2-yl]-3-prop-2-enyl-1,2,4-oxadiazole |
| SMILES | C=CCc1noc([C@H]2CCCO2)n1 |
| InChI | InChI=1S/C9H12N2O2/c1-2-4-8-10-9(13-11-8)7-5-3-6-12-7/h2,7H,1,3-6H2/t7-/m1/s1 |
| InChIKey | WDXXSTVKPJMKON-SSDOTTSWSA-N |
| XLogP | 1.65 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|