C12H13N3O2 — CID 97251152
5-[(2S)-oxolan-2-yl]-3-(pyridin-3-ylmethyl)-1,2,4-oxadiazole (PubChem CID 97251152) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-[(2S)-oxolan-2-yl]-3-(pyridin-3-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(2S)-oxolan-2-yl]-3-(pyridin-3-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97251152 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-[(2S)-oxolan-2-yl]-3-(pyridin-3-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1cncc(Cc2noc([C@@H]3CCCO3)n2)c1 |
| InChI | InChI=1S/C12H13N3O2/c1-3-9(8-13-5-1)7-11-14-12(17-15-11)10-4-2-6-16-10/h1,3,5,8,10H,2,4,6-7H2/t10-/m0/s1 |
| InChIKey | XGOGXSPJBOHVDW-JTQLQIEISA-N |
| XLogP | 1.91 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |