C9H13N3O2 — CID 115077815
5-(1-ethylpyrrolidin-2-yl)-1,2,4-oxadiazole-3-carbaldehyde (PubChem CID 115077815) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-(1-ethylpyrrolidin-2-yl)-1,2,4-oxadiazole-3-carbaldehyde.
| Compound Name | 5-(1-ethylpyrrolidin-2-yl)-1,2,4-oxadiazole-3-carbaldehyde |
|---|---|
| PubChem CID | 115077815 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 5-(1-ethylpyrrolidin-2-yl)-1,2,4-oxadiazole-3-carbaldehyde |
| SMILES | CCN1CCCC1c1nc(C=O)no1 |
| InChI | InChI=1S/C9H13N3O2/c1-2-12-5-3-4-7(12)9-10-8(6-13)11-14-9/h6-7H,2-5H2,1H3 |
| InChIKey | HSWHKKFUPPWCID-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|