C12H14N2O3 — CID 115079062
4-[[3-(2-hydroxypropyl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 115079062) has the molecular formula C12H14N2O3 and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-[[3-(2-hydroxypropyl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 4-[[3-(2-hydroxypropyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 115079062 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-[[3-(2-hydroxypropyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | CC(O)Cc1noc(Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H14N2O3/c1-8(15)6-11-13-12(17-14-11)7-9-2-4-10(16)5-3-9/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | LDYNAHQCFNAZFQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |