C7H12N4O — CID 115079643
3-(1-methylpyrrolidin-3-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 115079643) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-3-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1-methylpyrrolidin-3-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 115079643 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-(1-methylpyrrolidin-3-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | CN1CCC(c2noc(N)n2)C1 |
| InChI | InChI=1S/C7H12N4O/c1-11-3-2-5(4-11)6-9-7(8)12-10-6/h5H,2-4H2,1H3,(H2,8,9,10) |
| InChIKey | MXKHIQVEBOVLSI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |