C8H14N4O — CID 115079652
3-(1-methylpiperidin-4-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 115079652) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1-methylpiperidin-4-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 115079652 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | CN1CCC(c2noc(N)n2)CC1 |
| InChI | InChI=1S/C8H14N4O/c1-12-4-2-6(3-5-12)7-10-8(9)13-11-7/h6H,2-5H2,1H3,(H2,9,10,11) |
| InChIKey | BAEZDRDIBVTING-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |