C13H16N4O — CID 95817184
5-methyl-3-(1-pyridin-4-ylpiperidin-4-yl)-1,2,4-oxadiazole (PubChem CID 95817184) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-methyl-3-(1-pyridin-4-ylpiperidin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-(1-pyridin-4-ylpiperidin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95817184 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-methyl-3-(1-pyridin-4-ylpiperidin-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1nc(C2CCN(c3ccncc3)CC2)no1 |
| InChI | InChI=1S/C13H16N4O/c1-10-15-13(16-18-10)11-4-8-17(9-5-11)12-2-6-14-7-3-12/h2-3,6-7,11H,4-5,8-9H2,1H3 |
| InChIKey | HXFMWIARSTYDBB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |