C8H12N2O — CID 90327686
3-cyclopentyl-5-methyl-1,2,4-oxadiazole (PubChem CID 90327686) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-cyclopentyl-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-cyclopentyl-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90327686 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-cyclopentyl-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(C2CCCC2)no1 |
| InChI | InChI=1S/C8H12N2O/c1-6-9-8(10-11-6)7-4-2-3-5-7/h7H,2-5H2,1H3 |
| InChIKey | PHFYJHWPUYHIBN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |