C8H14N4O — CID 62596343
(3-cyclohexyl-1,2,4-oxadiazol-5-yl)hydrazine (PubChem CID 62596343) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (3-cyclohexyl-1,2,4-oxadiazol-5-yl)hydrazine.
| Compound Name | (3-cyclohexyl-1,2,4-oxadiazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 62596343 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (3-cyclohexyl-1,2,4-oxadiazol-5-yl)hydrazine |
| SMILES | NNc1nc(C2CCCCC2)no1 |
| InChI | InChI=1S/C8H14N4O/c9-11-8-10-7(12-13-8)6-4-2-1-3-5-6/h6H,1-5,9H2,(H,10,11,12) |
| InChIKey | WFPUKFXKUAIVSA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|