C8H13N3O — CID 64985459
3-cyclobutyl-N-ethyl-1,2,4-oxadiazol-5-amine (PubChem CID 64985459) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-cyclobutyl-N-ethyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-cyclobutyl-N-ethyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 64985459 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-cyclobutyl-N-ethyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCNc1nc(C2CCC2)no1 |
| InChI | InChI=1S/C8H13N3O/c1-2-9-8-10-7(11-12-8)6-4-3-5-6/h6H,2-5H2,1H3,(H,9,10,11) |
| InChIKey | AVUODHGPXGCQFT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |